* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105409-001 |
| English Synonyms: | WUXIAPPTEC WX105409-005 ; WUXIAPPTEC WX105409-001 ; WUXIAPPTEC WX105409-010 |
| MDL Number.: | MFCD17017414 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | FC1=C(C=CC=N1)[C@H]1CNCC11CCNC1=O |
| InChi: | InChI=1S/C12H14FN3O/c13-10-8(2-1-4-15-10)9-6-14-7-12(9)3-5-16-11(12)17/h1-2,4,9,14H,3,5-7H2,(H,16,17)/t9-,12?/m1/s1 |
| InChiKey: | InChIKey=WFAYZSSGEPFBCR-PKEIRNPWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.