* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105410-001 |
| English Synonyms: | WUXIAPPTEC WX105410-001 ; WUXIAPPTEC WX105410-010 ; WUXIAPPTEC WX105410-005 |
| MDL Number.: | MFCD17017415 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | O=C1NCCC11CNC[C@@H]1C1=CC=CN1 |
| InChi: | InChI=1S/C11H15N3O/c15-10-11(3-5-14-10)7-12-6-8(11)9-2-1-4-13-9/h1-2,4,8,12-13H,3,5-7H2,(H,14,15)/t8-,11?/m1/s1 |
| InChiKey: | InChIKey=IQSTVUVYGYTHAU-RZZZFEHKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.