* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105415-001 |
| English Synonyms: | WUXIAPPTEC WX105415-010 ; WUXIAPPTEC WX105415-005 ; WUXIAPPTEC WX105415-001 |
| MDL Number.: | MFCD17017420 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | O=C1NCCC[C@@]11CNC[C@@H]1C1=CC=CN1 |
| InChi: | InChI=1S/C12H17N3O/c16-11-12(4-2-6-15-11)8-13-7-9(12)10-3-1-5-14-10/h1,3,5,9,13-14H,2,4,6-8H2,(H,15,16)/t9-,12+/m1/s1 |
| InChiKey: | InChIKey=AOCIYFVYXFUBMT-SKDRFNHKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.