* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105416-001 |
| English Synonyms: | WUXIAPPTEC WX105416-001 ; WUXIAPPTEC WX105416-010 ; WUXIAPPTEC WX105416-005 |
| MDL Number.: | MFCD17017421 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | O=C1NCCC[C@@]11CNC[C@@H]1C1=CNN=C1 |
| InChi: | InChI=1S/C11H16N4O/c16-10-11(2-1-3-13-10)7-12-6-9(11)8-4-14-15-5-8/h4-5,9,12H,1-3,6-7H2,(H,13,16)(H,14,15)/t9-,11+/m1/s1 |
| InChiKey: | InChIKey=LYZOTCFJGUPUGO-KOLCDFICSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.