* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105417-001 |
| English Synonyms: | WUXIAPPTEC WX105417-005 ; WUXIAPPTEC WX105417-010 ; WUXIAPPTEC WX105417-001 |
| MDL Number.: | MFCD17017422 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | FC1=C(C=CC=N1)[C@H]1CNC[C@@]11OCCNC1=O |
| InChi: | InChI=1S/C12H14FN3O2/c13-10-8(2-1-3-15-10)9-6-14-7-12(9)11(17)16-4-5-18-12/h1-3,9,14H,4-7H2,(H,16,17)/t9-,12-/m1/s1 |
| InChiKey: | InChIKey=VAYYYIUDTWPEFB-BXKDBHETSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.