* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105419-001 |
| English Synonyms: | WUXIAPPTEC WX105419-010 ; WUXIAPPTEC WX105419-001 ; WUXIAPPTEC WX105419-005 |
| MDL Number.: | MFCD17017424 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2(CC1)NCCN1C=NC(Br)=C21 |
| InChi: | InChI=1S/C15H23BrN4O2/c1-14(2,3)22-13(21)19-7-4-15(5-8-19)11-12(16)17-10-20(11)9-6-18-15/h10,18H,4-9H2,1-3H3 |
| InChiKey: | InChIKey=BQFAPTYQXRMVRL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.