* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110340-001 |
| English Synonyms: | WUXIAPPTEC WX110340-010 ; WUXIAPPTEC WX110340-001 ; WUXIAPPTEC WX110340-005 |
| MDL Number.: | MFCD17017440 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | [H][C@@]12CCC(=O)N[C@]1([H])CC[C@H](N)C2 |
| InChi: | InChI=1S/C9H16N2O/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h6-8H,1-5,10H2,(H,11,12)/t6-,7-,8+/m0/s1 |
| InChiKey: | InChIKey=ZCBFBRBYKPZCHJ-BIIVOSGPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.