* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX110342-001 |
English Synonyms: | WUXIAPPTEC WX110342-001 ; WUXIAPPTEC WX110342-005 ; WUXIAPPTEC WX110342-010 |
MDL Number.: | MFCD17017442 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | [H][C@@]12CCCN[C@]1([H])CC[C@H](C2)C(=O)OCC |
InChi: | InChI=1S/C12H21NO2/c1-2-15-12(14)10-5-6-11-9(8-10)4-3-7-13-11/h9-11,13H,2-8H2,1H3/t9-,10+,11+/m0/s1 |
InChiKey: | InChIKey=UDPIZEZSKQQWPU-HBNTYKKESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.