* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX110343-001 |
English Synonyms: | WUXIAPPTEC WX110343-010 ; WUXIAPPTEC WX110343-001 ; WUXIAPPTEC WX110343-005 |
MDL Number.: | MFCD17017443 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | [H][C@@]12CCC(=O)N[C@]1([H])CC[C@H](C2)C(=O)OCC |
InChi: | InChI=1S/C12H19NO3/c1-2-16-12(15)9-3-5-10-8(7-9)4-6-11(14)13-10/h8-10H,2-7H2,1H3,(H,13,14)/t8-,9+,10+/m0/s1 |
InChiKey: | InChIKey=SUNPLONBTHGVCR-IVZWLZJFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.