* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX140155-001 |
English Synonyms: | WUXIAPPTEC WX140155-001 ; WUXIAPPTEC WX140155-005 ; WUXIAPPTEC WX140155-010 |
MDL Number.: | MFCD17017448 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | N[C@H]1CCC2=C(C1)C=CC(=O)N2 |
InChi: | InChI=1S/C9H12N2O/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1,4,7H,2-3,5,10H2,(H,11,12)/t7-/m0/s1 |
InChiKey: | InChIKey=IGEZGNFMAXDJNB-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.