* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-2H,3H,4H-PYRANO[2,3-B]PYRIDIN-3-AMINE |
| English Synonyms: | 7-CHLORO-2H,3H,4H-PYRANO[2,3-B]PYRIDIN-3-AMINE |
| MDL Number.: | MFCD17017450 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(nc2c1CC(CO2)N)Cl |
| InChi: | InChI=1S/C8H9ClN2O/c9-7-2-1-5-3-6(10)4-12-8(5)11-7/h1-2,6H,3-4,10H2 |
| InChiKey: | InChIKey=MOZUPDPTGKYQLI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.