* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX110347-001 |
English Synonyms: | WUXIAPPTEC WX110347-001 ; WUXIAPPTEC WX110347-005 ; WUXIAPPTEC WX110347-010 |
MDL Number.: | MFCD17017457 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | [H][C@]12C[C@H](N)[C@@H](O)[C@@]1([H])OC(C2)C(=O)OCC |
InChi: | InChI=1S/C10H17NO4/c1-2-14-10(13)7-4-5-3-6(11)8(12)9(5)15-7/h5-9,12H,2-4,11H2,1H3/t5-,6+,7?,8-,9+/m1/s1 |
InChiKey: | InChIKey=ZOJYFQSPKWAIBD-OVVPSANESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.