* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX110348-001 |
English Synonyms: | WUXIAPPTEC WX110348-005 ; WUXIAPPTEC WX110348-001 ; WUXIAPPTEC WX110348-010 |
MDL Number.: | MFCD17017458 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | [H][C@]12C[C@@H](O)[C@H](N)[C@@]1([H])OC(C2)C(=O)OCC |
InChi: | InChI=1S/C10H17NO4/c1-2-14-10(13)7-4-5-3-6(12)8(11)9(5)15-7/h5-9,12H,2-4,11H2,1H3/t5-,6-,7?,8+,9+/m1/s1 |
InChiKey: | InChIKey=DADOEDMHFROXDZ-FGRAQUDVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.