* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115263-001 |
| English Synonyms: | WUXIAPPTEC WX115263-005 ; WUXIAPPTEC WX115263-010 ; WUXIAPPTEC WX115263-001 |
| MDL Number.: | MFCD17017461 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | [H][C@]12C[C@@H]3NCCO[C@H]3[C@@]1([H])OC(C2)C(=O)OCC |
| InChi: | InChI=1S/C12H19NO4/c1-2-15-12(14)9-6-7-5-8-11(10(7)17-9)16-4-3-13-8/h7-11,13H,2-6H2,1H3/t7-,8+,9?,10+,11-/m1/s1 |
| InChiKey: | InChIKey=JIAFFCYGMWHQGU-NZIDRHGDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.