* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115264-001 |
| English Synonyms: | WUXIAPPTEC WX115264-001 ; WUXIAPPTEC WX115264-005 ; WUXIAPPTEC WX115264-010 |
| MDL Number.: | MFCD17017462 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | [H][C@@]12CC(O[C@]1([H])[C@H]1NC(=O)CO[C@@H]1C2)C(=O)OCC |
| InChi: | InChI=1S/C12H17NO5/c1-2-16-12(15)8-4-6-3-7-10(11(6)18-8)13-9(14)5-17-7/h6-8,10-11H,2-5H2,1H3,(H,13,14)/t6-,7-,8?,10+,11+/m1/s1 |
| InChiKey: | InChIKey=WFAZPOBCEXYVPL-UTJFIUJZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.