* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX115265-001 |
English Synonyms: | WUXIAPPTEC WX115265-010 ; WUXIAPPTEC WX115265-001 ; WUXIAPPTEC WX115265-005 |
MDL Number.: | MFCD17017463 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | [H][C@@]12CC(O[C@]1([H])[C@H]1NCCO[C@@H]1C2)C(=O)OCC |
InChi: | InChI=1S/C12H19NO4/c1-2-15-12(14)9-6-7-5-8-10(11(7)17-9)13-3-4-16-8/h7-11,13H,2-6H2,1H3/t7-,8-,9?,10+,11+/m1/s1 |
InChiKey: | InChIKey=JZMACYTVSKIIIL-XPQSWSMUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.