* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX115266-001 |
English Synonyms: | WUXIAPPTEC WX115266-010 ; WUXIAPPTEC WX115266-001 ; WUXIAPPTEC WX115266-005 |
MDL Number.: | MFCD17017464 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | [H][C@@]12CC(O[C@]1([H])C1=C(C2)NN=C1)C(=O)OCC |
InChi: | InChI=1S/C11H14N2O3/c1-2-15-11(14)9-4-6-3-8-7(5-12-13-8)10(6)16-9/h5-6,9-10H,2-4H2,1H3,(H,12,13)/t6-,9?,10+/m1/s1 |
InChiKey: | InChIKey=KHKPXJVEYZKECB-UEYWXQRQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.