* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115268-001 |
| English Synonyms: | WUXIAPPTEC WX115268-001 ; WUXIAPPTEC WX115268-005 ; WUXIAPPTEC WX115268-010 |
| MDL Number.: | MFCD17017466 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | [H][C@@]12CC(O[C@]1([H])C1=C(C2)C=NC(SC)=N1)C(=O)OCC |
| InChi: | InChI=1S/C13H16N2O3S/c1-3-17-12(16)9-5-7-4-8-6-14-13(19-2)15-10(8)11(7)18-9/h6-7,9,11H,3-5H2,1-2H3/t7-,9?,11+/m1/s1 |
| InChiKey: | InChIKey=JCVUOAMKHKMEPO-DLSRMIIKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.