* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115269-001 |
| English Synonyms: | WUXIAPPTEC WX115269-010 ; WUXIAPPTEC WX115269-001 ; WUXIAPPTEC WX115269-005 |
| MDL Number.: | MFCD17017467 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | [H][C@]12C[C@@H]3ON=C(Br)[C@@H]3[C@@]1([H])OC(C2)C(=O)OCC |
| InChi: | InChI=1S/C11H14BrNO4/c1-2-15-11(14)7-4-5-3-6-8(9(5)16-7)10(12)13-17-6/h5-9H,2-4H2,1H3/t5-,6+,7?,8+,9+/m1/s1 |
| InChiKey: | InChIKey=LQBJUAPWHQDUBF-VTBPIOEASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.