* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX115270-001 |
English Synonyms: | WUXIAPPTEC WX115270-010 ; WUXIAPPTEC WX115270-005 ; WUXIAPPTEC WX115270-001 |
MDL Number.: | MFCD17017468 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOC(=O)C1CC2CN3C(C=O)=CN=C3C2O1 |
InChi: | InChI=1S/C12H14N2O4/c1-2-17-12(16)9-3-7-5-14-8(6-15)4-13-11(14)10(7)18-9/h4,6-7,9-10H,2-3,5H2,1H3 |
InChiKey: | InChIKey=WMAHHJKSSKUSDA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.