* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115276-001 |
| English Synonyms: | WUXIAPPTEC WX115276-005 ; WUXIAPPTEC WX115276-010 ; WUXIAPPTEC WX115276-001 |
| MDL Number.: | MFCD17017474 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | [H][C@@]12CC(O[C@]1([H])C1=C(C2)C=NN1)C(=O)OCC |
| InChi: | InChI=1S/C11H14N2O3/c1-2-15-11(14)8-4-6-3-7-5-12-13-9(7)10(6)16-8/h5-6,8,10H,2-4H2,1H3,(H,12,13)/t6-,8?,10+/m1/s1 |
| InChiKey: | InChIKey=LIMNZLKPPOYRLR-KODUZNSBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.