* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX115279-001 |
English Synonyms: | WUXIAPPTEC WX115279-010 ; WUXIAPPTEC WX115279-005 ; WUXIAPPTEC WX115279-001 |
MDL Number.: | MFCD17017480 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | [H][C@]12CN(C[C@@]1([H])C1=C(N=CS1)[C@@H]2C(=O)OCC)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C19H20N2O4S/c1-2-24-18(22)15-13-8-21(9-14(13)17-16(15)20-11-26-17)19(23)25-10-12-6-4-3-5-7-12/h3-7,11,13-15H,2,8-10H2,1H3/t13-,14+,15+/m0/s1 |
InChiKey: | InChIKey=MNIRWEAKKGGQQU-RRFJBIMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.