* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115280-001 |
| English Synonyms: | WUXIAPPTEC WX115280-010 ; WUXIAPPTEC WX115280-001 ; WUXIAPPTEC WX115280-005 |
| MDL Number.: | MFCD17017481 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | [H][C@]12CN(C[C@@]1([H])C1=C(N=C(N)S1)[C@@H]2C(=O)OCC)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C19H21N3O4S/c1-2-25-17(23)14-12-8-22(9-13(12)16-15(14)21-18(20)27-16)19(24)26-10-11-6-4-3-5-7-11/h3-7,12-14H,2,8-10H2,1H3,(H2,20,21)/t12-,13+,14+/m0/s1 |
| InChiKey: | InChIKey=LMCNLUZCNUZYHA-BFHYXJOUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.