* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115284-001 |
| English Synonyms: | WUXIAPPTEC WX115284-001 ; WUXIAPPTEC WX115284-010 ; WUXIAPPTEC WX115284-005 |
| MDL Number.: | MFCD17017485 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | OC(=O)C1OCC2(CN(CC12)C(=O)OCC1=CC=CC=C1)C1=NC=CS1 |
| InChi: | InChI=1S/C18H18N2O5S/c21-15(22)14-13-8-20(17(23)24-9-12-4-2-1-3-5-12)10-18(13,11-25-14)16-19-6-7-26-16/h1-7,13-14H,8-11H2,(H,21,22) |
| InChiKey: | InChIKey=HXLVCZFHXFVWTI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.