* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110353-001 |
| English Synonyms: | WUXIAPPTEC WX110353-005 ; WUXIAPPTEC WX110353-001 ; WUXIAPPTEC WX110353-010 |
| MDL Number.: | MFCD17017491 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C1CC2CN(CC2N1C(=O)OC(C)(C)C)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C22H30N2O6/c1-5-28-19(25)17-11-16-12-23(20(26)29-14-15-9-7-6-8-10-15)13-18(16)24(17)21(27)30-22(2,3)4/h6-10,16-18H,5,11-14H2,1-4H3 |
| InChiKey: | InChIKey=YAJADAVODTZVSD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.