* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115291-001 |
| English Synonyms: | WUXIAPPTEC WX115291-010 ; WUXIAPPTEC WX115291-001 ; WUXIAPPTEC WX115291-005 |
| MDL Number.: | MFCD17017495 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1CCC2NCCNC(=O)C2(C1)C1=CC=CC=C1 |
| InChi: | InChI=1S/C19H27N3O3/c1-18(2,3)25-17(24)22-12-9-15-19(13-22,14-7-5-4-6-8-14)16(23)21-11-10-20-15/h4-8,15,20H,9-13H2,1-3H3,(H,21,23) |
| InChiKey: | InChIKey=HZMLSOXQUNJYRD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.