* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125098-001 |
| English Synonyms: | WUXIAPPTEC WX125098-010 ; WUXIAPPTEC WX125098-005 ; WUXIAPPTEC WX125098-001 |
| MDL Number.: | MFCD17017499 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | OC(=O)C1OC2CC1C1=C2C=CC(Cl)=N1 |
| InChi: | InChI=1S/C10H8ClNO3/c11-7-2-1-4-6-3-5(8(4)12-7)9(15-6)10(13)14/h1-2,5-6,9H,3H2,(H,13,14) |
| InChiKey: | InChIKey=MQVVPRAXWWQUHO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.