* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125100-001 |
| English Synonyms: | WUXIAPPTEC WX125100-005 ; WUXIAPPTEC WX125100-010 ; WUXIAPPTEC WX125100-001 |
| MDL Number.: | MFCD17017501 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | [H][C@@]12C[C@@]([H])(C(O1)C(=O)OCC)N1C(C=O)=CN=C21 |
| InChi: | InChI=1S/C11H12N2O4/c1-2-16-11(15)9-7-3-8(17-9)10-12-4-6(5-14)13(7)10/h4-5,7-9H,2-3H2,1H3/t7-,8-,9?/m0/s1 |
| InChiKey: | InChIKey=RKCATGHLCMBQCI-JVIMKECRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.