* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105422-001 |
| English Synonyms: | WUXIAPPTEC WX105422-001 ; WUXIAPPTEC WX105422-010 ; WUXIAPPTEC WX105422-005 |
| MDL Number.: | MFCD17017503 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CSC1=NC=C2CC3(CCN(CC3)C(=O)OC(C)(C)C)CNC2=N1 |
| InChi: | InChI=1S/C17H26N4O2S/c1-16(2,3)23-15(22)21-7-5-17(6-8-21)9-12-10-18-14(24-4)20-13(12)19-11-17/h10H,5-9,11H2,1-4H3,(H,18,19,20) |
| InChiKey: | InChIKey=UDNDVEHRZMOCKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.