* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115294-001 |
| English Synonyms: | WUXIAPPTEC WX115294-010 ; WUXIAPPTEC WX115294-005 ; WUXIAPPTEC WX115294-001 |
| MDL Number.: | MFCD17017515 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | [H][C@]12CN(C[C@@]1([H])C1=C(CC2)C(O)=CN=C1)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C16H22N2O3/c1-16(2,3)21-15(20)18-8-10-4-5-11-12(13(10)9-18)6-17-7-14(11)19/h6-7,10,13,19H,4-5,8-9H2,1-3H3/t10-,13+/m0/s1 |
| InChiKey: | InChIKey=XQEQDPGMIIHVEL-GXFFZTMASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.