* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-PHENYL-1,3A,5,6,7,7A-HEXAHYDRO-1,4-METHANO-INDEN-4-YLAMINE |
| English Synonyms: | 8-PHENYL-1,3A,5,6,7,7A-HEXAHYDRO-1,4-METHANO-INDEN-4-YLAMINE |
| MDL Number.: | MFCD17017529 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | NC12CCCC3C(C=CC13)C2C1=CC=CC=C1 |
| InChi: | InChI=1S/C16H19N/c17-16-10-4-7-12-13(8-9-14(12)16)15(16)11-5-2-1-3-6-11/h1-3,5-6,8-9,12-15H,4,7,10,17H2 |
| InChiKey: | InChIKey=HHYZUIFAFXMTMK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.