* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PHENYL-2,6-DIAZA-BICYCLO[3.2.1]OCTAN-3-ONE |
| English Synonyms: | 7-PHENYL-2,6-DIAZA-BICYCLO[3.2.1]OCTAN-3-ONE |
| MDL Number.: | MFCD17017537 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C1(=CC=CC=C1)C1NC2CC(NC1C2)=O |
| InChi: | InChI=1S/C12H14N2O/c15-11-7-9-6-10(14-11)12(13-9)8-4-2-1-3-5-8/h1-5,9-10,12-13H,6-7H2,(H,14,15) |
| InChiKey: | InChIKey=UCURXDKVNKOIAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.