* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115222-001 |
| English Synonyms: | WUXIAPPTEC WX115222-001 ; WUXIAPPTEC WX115222-005 ; WUXIAPPTEC WX115222-010 |
| MDL Number.: | MFCD17017547 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1CC[C@H]2NC(=O)[C@@H]3CNC[C@]23C1 |
| InChi: | InChI=1S/C14H23N3O3/c1-13(2,3)20-12(19)17-5-4-10-14(8-17)7-15-6-9(14)11(18)16-10/h9-10,15H,4-8H2,1-3H3,(H,16,18)/t9-,10+,14+/m0/s1 |
| InChiKey: | InChIKey=FGAJAEMOFPMCJI-IMSIIYSGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.