* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115228-001 |
| English Synonyms: | WUXIAPPTEC WX115228-005 ; WUXIAPPTEC WX115228-001 ; WUXIAPPTEC WX115228-010 |
| MDL Number.: | MFCD17017553 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C[C@H]2C(=O)N[C@@H]3COC[C@]23C1 |
| InChi: | InChI=1S/C13H20N2O4/c1-12(2,3)19-11(17)15-4-8-10(16)14-9-5-18-7-13(8,9)6-15/h8-9H,4-7H2,1-3H3,(H,14,16)/t8-,9+,13+/m0/s1 |
| InChiKey: | InChIKey=MKLJDGWHMTUKJC-IGJMFERPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.