* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115229-001 |
| English Synonyms: | WUXIAPPTEC WX115229-005 ; WUXIAPPTEC WX115229-001 ; WUXIAPPTEC WX115229-010 |
| MDL Number.: | MFCD17017554 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C[C@H]2CN[C@@H]3COC[C@]23C1 |
| InChi: | InChI=1S/C13H22N2O3/c1-12(2,3)18-11(16)15-5-9-4-14-10-6-17-8-13(9,10)7-15/h9-10,14H,4-8H2,1-3H3/t9-,10-,13-/m1/s1 |
| InChiKey: | InChIKey=GUXJQUCIPHMJCC-GIPNMCIBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.