* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115286-001 |
| English Synonyms: | WUXIAPPTEC WX115286-001 ; WUXIAPPTEC WX115286-010 ; WUXIAPPTEC WX115286-005 |
| MDL Number.: | MFCD17017558 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1CC2C(=O)NC3CCCNC23C1 |
| InChi: | InChI=1S/C14H23N3O3/c1-13(2,3)20-12(19)17-7-9-11(18)16-10-5-4-6-15-14(9,10)8-17/h9-10,15H,4-8H2,1-3H3,(H,16,18) |
| InChiKey: | InChIKey=HIBGZGQPZJFSQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.