* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115301-001 |
| English Synonyms: | WUXIAPPTEC WX115301-010 ; WUXIAPPTEC WX115301-005 ; WUXIAPPTEC WX115301-001 |
| MDL Number.: | MFCD17017562 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2CNC(=O)C3CN(CC23C1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C23H31N3O5/c1-22(2,3)31-21(29)25-10-9-17-11-24-19(27)18-12-26(15-23(17,18)14-25)20(28)30-13-16-7-5-4-6-8-16/h4-8,17-18H,9-15H2,1-3H3,(H,24,27) |
| InChiKey: | InChIKey=QFDLOLGLHYBQDU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.