* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115308-001 |
| English Synonyms: | WUXIAPPTEC WX115308-005 ; WUXIAPPTEC WX115308-010 ; WUXIAPPTEC WX115308-001 |
| MDL Number.: | MFCD17017563 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2C(=O)NCC3COCCC23C1 |
| InChi: | InChI=1S/C15H24N2O4/c1-14(2,3)21-13(19)17-7-11-12(18)16-6-10-8-20-5-4-15(10,11)9-17/h10-11H,4-9H2,1-3H3,(H,16,18) |
| InChiKey: | InChIKey=ZZMHYYKWDMYGNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.