* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115305-001 |
| English Synonyms: | WUXIAPPTEC WX115305-005 ; WUXIAPPTEC WX115305-010 ; WUXIAPPTEC WX115305-001 |
| MDL Number.: | MFCD17017568 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2C(=O)NCC3CCOC23C1 |
| InChi: | InChI=1S/C14H22N2O4/c1-13(2,3)20-12(18)16-7-10-11(17)15-6-9-4-5-19-14(9,10)8-16/h9-10H,4-8H2,1-3H3,(H,15,17) |
| InChiKey: | InChIKey=UGIZDOUPTHGNPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.