* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115310-001 |
| English Synonyms: | WUXIAPPTEC WX115310-010 ; WUXIAPPTEC WX115310-001 ; WUXIAPPTEC WX115310-005 |
| MDL Number.: | MFCD17017571 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2CNCC3CN(CC23C1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C22H31N3O4/c1-21(2,3)29-20(27)25-12-18-10-23-9-17-11-24(14-22(17,18)15-25)19(26)28-13-16-7-5-4-6-8-16/h4-8,17-18,23H,9-15H2,1-3H3 |
| InChiKey: | InChIKey=OFTHLHOKVGLVNW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.