* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115313-001 |
English Synonyms: | WUXIAPPTEC WX115313-010 ; WUXIAPPTEC WX115313-001 ; WUXIAPPTEC WX115313-005 |
MDL Number.: | MFCD17017574 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CCC23CN(CC2CNCC3C1)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C23H33N3O4/c1-22(2,3)30-21(28)25-10-9-23-16-26(14-19(23)12-24-11-18(23)13-25)20(27)29-15-17-7-5-4-6-8-17/h4-8,18-19,24H,9-16H2,1-3H3 |
InChiKey: | InChIKey=URSLFDMGIUXSBZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.