* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115323-001 |
| English Synonyms: | WUXIAPPTEC WX115323-001 ; WUXIAPPTEC WX115323-010 ; WUXIAPPTEC WX115323-005 |
| MDL Number.: | MFCD17017584 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2OCC3=CN=C(Cl)N=C3NC2C1 |
| InChi: | InChI=1S/C15H21ClN4O3/c1-15(2,3)23-14(21)20-5-4-11-10(7-20)18-12-9(8-22-11)6-17-13(16)19-12/h6,10-11H,4-5,7-8H2,1-3H3,(H,17,18,19) |
| InChiKey: | InChIKey=VWOIFMVDPJMYCC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.