* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115324-001 |
English Synonyms: | WUXIAPPTEC WX115324-001 ; WUXIAPPTEC WX115324-005 ; WUXIAPPTEC WX115324-010 |
MDL Number.: | MFCD17017585 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CCC2OCC3=CC=C(Cl)N=C3NC2C1 |
InChi: | InChI=1S/C16H22ClN3O3/c1-16(2,3)23-15(21)20-7-6-12-11(8-20)18-14-10(9-22-12)4-5-13(17)19-14/h4-5,11-12H,6-9H2,1-3H3,(H,18,19) |
InChiKey: | InChIKey=HDIOKEGWJVZYHS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.