* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115329-001 |
English Synonyms: | WUXIAPPTEC WX115329-001 ; WUXIAPPTEC WX115329-005 ; WUXIAPPTEC WX115329-010 |
MDL Number.: | MFCD17017590 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)(C)OC(=O)N1CCC2NCC3=CC=C(Cl)N=C3NC2C1 |
InChi: | InChI=1S/C16H23ClN4O2/c1-16(2,3)23-15(22)21-7-6-11-12(9-21)19-14-10(8-18-11)4-5-13(17)20-14/h4-5,11-12,18H,6-9H2,1-3H3,(H,19,20) |
InChiKey: | InChIKey=IHKWMNLFCGBVFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.