* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115330-001 |
| English Synonyms: | WUXIAPPTEC WX115330-005 ; WUXIAPPTEC WX115330-010 ; WUXIAPPTEC WX115330-001 |
| MDL Number.: | MFCD17017591 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1CCC2NCC3=CN=C(Cl)N=C3NC2C1 |
| InChi: | InChI=1S/C15H22ClN5O2/c1-15(2,3)23-14(22)21-5-4-10-11(8-21)19-12-9(6-17-10)7-18-13(16)20-12/h7,10-11,17H,4-6,8H2,1-3H3,(H,18,19,20) |
| InChiKey: | InChIKey=NXMBTQGSUPWOAQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.