* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115331-001 |
| English Synonyms: | WUXIAPPTEC WX115331-010 ; WUXIAPPTEC WX115331-005 ; WUXIAPPTEC WX115331-001 |
| MDL Number.: | MFCD17017592 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1CCC2NC3=NC(Cl)=CC=C3CNC2C1 |
| InChi: | InChI=1S/C16H23ClN4O2/c1-16(2,3)23-15(22)21-7-6-11-12(9-21)18-8-10-4-5-13(17)20-14(10)19-11/h4-5,11-12,18H,6-9H2,1-3H3,(H,19,20) |
| InChiKey: | InChIKey=ULDIAPFXKCDUAQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.