* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX145112-001 |
English Synonyms: | WUXIAPPTEC WX145112-010 ; WUXIAPPTEC WX145112-005 ; WUXIAPPTEC WX145112-001 |
MDL Number.: | MFCD17017594 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CCC2=C(C1)C1=C(NCC1)C=C2 |
InChi: | InChI=1S/C16H22N2O2/c1-16(2,3)20-15(19)18-9-7-11-4-5-14-12(6-8-17-14)13(11)10-18/h4-5,17H,6-10H2,1-3H3 |
InChiKey: | InChIKey=ZQFGAOUQMRWKOY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.