* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110362-001 |
| English Synonyms: | WUXIAPPTEC WX110362-010 ; WUXIAPPTEC WX110362-001 ; WUXIAPPTEC WX110362-005 |
| MDL Number.: | MFCD17017597 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C[C@@H](F)[C@@H]2NC(=O)CO[C@@H]2C1 |
| InChi: | InChI=1S/C12H19FN2O4/c1-12(2,3)19-11(17)15-4-7(13)10-8(5-15)18-6-9(16)14-10/h7-8,10H,4-6H2,1-3H3,(H,14,16)/t7-,8-,10+/m1/s1 |
| InChiKey: | InChIKey=ANRVYGNDOWKSQF-MRTMQBJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.