* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110363-001 |
English Synonyms: | WUXIAPPTEC WX110363-001 ; WUXIAPPTEC WX110363-005 ; WUXIAPPTEC WX110363-010 |
MDL Number.: | MFCD17017598 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@@H](F)[C@@H]2NCCO[C@@H]2C1 |
InChi: | InChI=1S/C12H21FN2O3/c1-12(2,3)18-11(16)15-6-8(13)10-9(7-15)17-5-4-14-10/h8-10,14H,4-7H2,1-3H3/t8-,9-,10+/m1/s1 |
InChiKey: | InChIKey=DINUSMJBOXFQSK-BBBLOLIVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.