* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110368-001 |
| English Synonyms: | WUXIAPPTEC WX110368-010 ; WUXIAPPTEC WX110368-005 ; WUXIAPPTEC WX110368-001 |
| MDL Number.: | MFCD17017603 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C[C@@H](F)[C@H]2OCCN[C@H]2C1 |
| InChi: | InChI=1S/C12H21FN2O3/c1-12(2,3)18-11(16)15-6-8(13)10-9(7-15)14-4-5-17-10/h8-10,14H,4-7H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChiKey: | InChIKey=ZPJVVASQWIRGCF-KXUCPTDWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.